Prix FOB
Obtenir le dernier prix1.1 ~ 1.3 / Kilogram
|1 Metric Ton Minimum Order
Pays:
China
N ° de modèle:
-
Prix FOB:
1.1 ~ 1.3 / Kilogram Obtenir le dernier prix
Localité:
-
Prix de commande minimale:
1.1 per Kilogram
Commande minimale:
1 Metric Ton
Packaging Detail:
240kg/steel drum, 80 drums in 1x20'FCL.
Heure de livraison:
2 Weeks approx.
Capacité de Fournir:
1000 Metric Ton per Month
Payment Type:
-
Groupe de produits :
Molecule  Formula: C9H*4O6
Molecule   Weight: **8,*1
CAS NO.: *******1
Constitutional   Formula : CH3COOCH2CH(CH3COO)CH2(CH3COO)
Synonyms: Glycerol triacetate
Â
Â
| Parameter | Unit | Index |
| Appearance |  | Clear liquid,free from suspended matter |
| Odour |  | Essentially odourless |
| Chrominance | APHA | ≤ *5 |
| Purity (GC) | % | ≥ *9.5 |
| Acidity (As HAC) | % | ≤0.*1 |
| Density | Â | 1.**4~1.**4 |
| Refraction Index (*0°C/D) |  | 1.**0~1.**5 |
| Moisture | % | ≤ 0.1 |
| Arsenic (AS) | mg/kg | ≤ 1 |
| Heavy Metals | mg/kg | ≤ 5 |
| Viscosity(*0) | cp | *1~*0 |
| Unsaturated Compounds |  | Pass |
| Specific Gravity(*0) |  | 1.**4~1.**4 |
| Item Name | Parameter | Index |
| Hot Melt Adhesive Glue for Book Binding | Appearance | White flake solid particles |
| Softening Point | ≥*2 | |
| Tensile Strength(mpa) | ≥4 | |
| Elongation at break | ≥**0 | |
| Melt Viscosity(**0°C pa.s) | 4.**6.5 | |
| Brittleness Temperature °C | <0°C | |
| Hot Melt Adhesive Glue for Box Sealing | Appearance | Light Yellow or Milky White Solid Particles |
| Softening Point | **0°C±*0 | |
| Elongation at break | ≥**0 | |
| Melt Viscosity(**0°C) | ***0±**0mpa.s | |
| Ingredient | EVA, resin | |
| Toxicity | Non-toxic | |
| Open time | **3s | |
| Setting time | **2s | |
| Suggested running temperature | ******5°C | |
| Validity period | *8 months approx. | |
| Storage environment | Clean and dry environment | |
|
Hot Melt Adhesive Glue for Straw Fixing  |
Appearance | White flake solid particles |
| Softening Point | **0°C±9 | |
| Elongation at break | ≥**0 | |
| Melt Viscosity(**0°C) | ***0±**0mpa.s | |
| Melt Viscosity(**0°C) | ***0±**0mpa.s | |
| Ingredient | EVA, resin | |
| Toxicity | Non-toxic | |
| Open time | **3s | |
| Setting time | **2s | |
| Suggested running temperature | ******0°C | |
| Validity period | *2 months approx. | |
| Storage environment | Clean and dry environment | |
| Hot Melt Adhesive Glue for Cable | Appearance | Light Yellow |
| Toxicity | None | |
| Solid | **0% | |
| Viscosity | *+/-*(*)Â @******************** | |
| Soften point | *0±5°C | |
| Recommended running range | ******5°C | |
| Hot Melt Adhesive Glue for Gold Card | Appearance | Milky White Liquid |
| Viscosity(*5°C) | ***0±**0mpa.s | |
| Solid Content(%) | *0±5 | |
| PHÂ | 5~7 | |
| Character | Non-toxic,tasteless | |
| Hot Melt Adhesive Glue for Mouth Stick | Appearance | Translucent Milky White |
| Viscosity(**0°C) | ***0±**0mpa.s | |
| Softening Point(ring and ball method) | **0°C±5 | |
| Open Time | 1~2 Seconds | |
| Shear Strength(*2.5mmX*5mm) | >1.6Mpa |
| Pays: | China |
| N ° de modèle: | - |
| Prix FOB: | 1.1 ~ 1.3 / Kilogram Obtenir le dernier prix |
| Localité: | - |
| Prix de commande minimale: | 1.1 per Kilogram |
| Commande minimale: | 1 Metric Ton |
| Packaging Detail: | 240kg/steel drum, 80 drums in 1x20'FCL. |
| Heure de livraison: | 2 Weeks approx. |
| Capacité de Fournir: | 1000 Metric Ton per Month |
| Payment Type: | - |
| Groupe de produits : | triacetin |
